C13H22N2 — CID 123851663
N-[(3,8,8-trimethylazocin-3-yl)methyl]ethanamine (PubChem CID 123851663) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N-[(3,8,8-trimethylazocin-3-yl)methyl]ethanamine.
| Compound Name | N-[(3,8,8-trimethylazocin-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 123851663 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N-[(3,8,8-trimethylazocin-3-yl)methyl]ethanamine |
| SMILES | CCNCC1(C)C=CC=CC(C)(C)/N=C\1 |
| InChI | InChI=1S/C13H22N2/c1-5-14-10-13(4)9-7-6-8-12(2,3)15-11-13/h6-9,11,14H,5,10H2,1-4H3/b8-6?,9-7?,15-11- |
| InChIKey | WNZCNNGJDFXUSZ-PTFMKKKJSA-N |
| XLogP | 2.58 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |