C17H27N3 — CID 145423526
N'-[7-ethenyl-3-methyl-6-[(Z)-prop-1-enyl]azepin-3-yl]-N-ethylpropane-1,3-diamine (PubChem CID 145423526) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is N'-[7-ethenyl-3-methyl-6-[(Z)-prop-1-enyl]azepin-3-yl]-N-ethylpropane-1,3-diamine.
| Compound Name | N'-[7-ethenyl-3-methyl-6-[(Z)-prop-1-enyl]azepin-3-yl]-N-ethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 145423526 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | N'-[7-ethenyl-3-methyl-6-[(Z)-prop-1-enyl]azepin-3-yl]-N-ethylpropane-1,3-diamine |
| SMILES | C=CC1=C(/C=C\C)C=CC(C)(NCCCNCC)C=N1 |
| InChI | InChI=1S/C17H27N3/c1-5-9-15-10-11-17(4,14-19-16(15)6-2)20-13-8-12-18-7-3/h5-6,9-11,14,18,20H,2,7-8,12-13H2,1,3-4H3/b9-5- |
| InChIKey | KPSHGZXLMJQTHO-UITAMQMPSA-N |
| XLogP | 2.99 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|