C16H30N2 — CID 134402656
(2Z,3E)-1-N,3-N-ditert-butyl-2-ethylidenehexa-3,5-diene-1,3-diamine (PubChem CID 134402656) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is (2Z,3E)-1-N,3-N-ditert-butyl-2-ethylidenehexa-3,5-diene-1,3-diamine.
| Compound Name | (2Z,3E)-1-N,3-N-ditert-butyl-2-ethylidenehexa-3,5-diene-1,3-diamine |
|---|---|
| PubChem CID | 134402656 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | (2Z,3E)-1-N,3-N-ditert-butyl-2-ethylidenehexa-3,5-diene-1,3-diamine |
| SMILES | C=C/C=C(NC(C)(C)C)\C(=C/C)CNC(C)(C)C |
| InChI | InChI=1S/C16H30N2/c1-9-11-14(18-16(6,7)8)13(10-2)12-17-15(3,4)5/h9-11,17-18H,1,12H2,2-8H3/b13-10-,14-11+ |
| InChIKey | GCRRRTVNKGEZJQ-FXYWYECCSA-N |
| XLogP | 3.78 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|