C9H16N2 — CID 155394759
(3Z)-N-methyl-3-(methyliminomethyl)hexa-3,5-dien-2-amine (PubChem CID 155394759) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (3Z)-N-methyl-3-(methyliminomethyl)hexa-3,5-dien-2-amine.
| Compound Name | (3Z)-N-methyl-3-(methyliminomethyl)hexa-3,5-dien-2-amine |
|---|---|
| PubChem CID | 155394759 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (3Z)-N-methyl-3-(methyliminomethyl)hexa-3,5-dien-2-amine |
| SMILES | C=C/C=C(\C=N\C)C(C)NC |
| InChI | InChI=1S/C9H16N2/c1-5-6-9(7-10-3)8(2)11-4/h5-8,11H,1H2,2-4H3/b9-6+,10-7+ |
| InChIKey | JXCCUMKMBMRILE-KZZDLZNXSA-N |
| XLogP | 1.41 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|