C23H34FN — CID 143714631
6-[4-fluoro-2-(3-methylpent-1-en-3-yl)phenyl]-1-methyl-2H-pyridine;pentane (PubChem CID 143714631) has the molecular formula C23H34FN and a molecular weight of 343.53 g/mol. Its IUPAC name is 6-[4-fluoro-2-(3-methylpent-1-en-3-yl)phenyl]-1-methyl-2H-pyridine;pentane.
| Compound Name | 6-[4-fluoro-2-(3-methylpent-1-en-3-yl)phenyl]-1-methyl-2H-pyridine;pentane |
|---|---|
| PubChem CID | 143714631 |
| Molecular Formula | C23H34FN |
| Molecular Weight | 343.53 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | 6-[4-fluoro-2-(3-methylpent-1-en-3-yl)phenyl]-1-methyl-2H-pyridine;pentane |
| SMILES | C=CC(C)(CC)c1cc(F)ccc1C1=CC=CCN1C.CCCCC |
| InChI | InChI=1S/C18H22FN.C5H12/c1-5-18(3,6-2)16-13-14(19)10-11-15(16)17-9-7-8-12-20(17)4;1-3-5-4-2/h5,7-11,13H,1,6,12H2,2-4H3;3-5H2,1-2H3 |
| InChIKey | HTYKGIIPTQMNHY-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.53 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|