C10H18N4 — CID 143715745
(E,4Z)-N-methyl-4-[(E)-1-(methylamino)prop-1-enyl]imino-N-(methylideneamino)but-2-en-2-amine (PubChem CID 143715745) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is (E,4Z)-N-methyl-4-[(E)-1-(methylamino)prop-1-enyl]imino-N-(methylideneamino)but-2-en-2-amine.
| Compound Name | (E,4Z)-N-methyl-4-[(E)-1-(methylamino)prop-1-enyl]imino-N-(methylideneamino)but-2-en-2-amine |
|---|---|
| PubChem CID | 143715745 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | (E,4Z)-N-methyl-4-[(E)-1-(methylamino)prop-1-enyl]imino-N-(methylideneamino)but-2-en-2-amine |
| SMILES | C=NN(C)/C(C)=C/C=N\C(=C\C)NC |
| InChI | InChI=1S/C10H18N4/c1-6-10(11-3)13-8-7-9(2)14(5)12-4/h6-8,11H,4H2,1-3,5H3/b9-7+,10-6+,13-8- |
| InChIKey | CJJCKFUONACAPZ-FCIWYHDOSA-N |
| XLogP | 1.59 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|