C21H19ClN6O2S — CID 143716744
N-[[1-[3-chloro-4-(dimethylaminosulfanyl)phenyl]pyrazol-4-yl]methyl]-3-formylimidazo[1,2-a]pyridine-8-carboxamide (PubChem CID 143716744) has the molecular formula C21H19ClN6O2S and a molecular weight of 454.94 g/mol. Its IUPAC name is N-[[1-[3-chloro-4-(dimethylaminosulfanyl)phenyl]pyrazol-4-yl]methyl]-3-formylimidazo[1,2-a]pyridine-8-carboxamide.
| Compound Name | N-[[1-[3-chloro-4-(dimethylaminosulfanyl)phenyl]pyrazol-4-yl]methyl]-3-formylimidazo[1,2-a]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 143716744 |
| Molecular Formula | C21H19ClN6O2S |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | N-[[1-[3-chloro-4-(dimethylaminosulfanyl)phenyl]pyrazol-4-yl]methyl]-3-formylimidazo[1,2-a]pyridine-8-carboxamide |
| SMILES | CN(C)Sc1ccc(-n2cc(CNC(=O)c3cccn4c(C=O)cnc34)cn2)cc1Cl |
| InChI | InChI=1S/C21H19ClN6O2S/c1-26(2)31-19-6-5-15(8-18(19)22)28-12-14(10-25-28)9-24-21(30)17-4-3-7-27-16(13-29)11-23-20(17)27/h3-8,10-13H,9H2,1-2H3,(H,24,30) |
| InChIKey | QAXHPOZEIGMYSM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 84.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|