C17H24F2N4O2S — CID 143718615
5-(aminomethylideneamino)-N-[5-(1,1-difluoroethyl)-2-ethylsulfanyl-3-formamidophenyl]pentanamide (PubChem CID 143718615) has the molecular formula C17H24F2N4O2S and a molecular weight of 386.47 g/mol. Its IUPAC name is 5-(aminomethylideneamino)-N-[5-(1,1-difluoroethyl)-2-ethylsulfanyl-3-formamidophenyl]pentanamide.
| Compound Name | 5-(aminomethylideneamino)-N-[5-(1,1-difluoroethyl)-2-ethylsulfanyl-3-formamidophenyl]pentanamide |
|---|---|
| PubChem CID | 143718615 |
| Molecular Formula | C17H24F2N4O2S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 5-(aminomethylideneamino)-N-[5-(1,1-difluoroethyl)-2-ethylsulfanyl-3-formamidophenyl]pentanamide |
| SMILES | CCSc1c(NC=O)cc(C(C)(F)F)cc1NC(=O)CCCC/N=C/N |
| InChI | InChI=1S/C17H24F2N4O2S/c1-3-26-16-13(22-11-24)8-12(17(2,18)19)9-14(16)23-15(25)6-4-5-7-21-10-20/h8-11H,3-7H2,1-2H3,(H2,20,21)(H,22,24)(H,23,25) |
| InChIKey | QERPWPPZZXBEPC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|