C16H30 — CID 143721340
(E,8Z)-8-ethylidene-7-methyltridec-4-ene (PubChem CID 143721340) has the molecular formula C16H30 and a molecular weight of 222.42 g/mol. Its IUPAC name is (E,8Z)-8-ethylidene-7-methyltridec-4-ene.
| Compound Name | (E,8Z)-8-ethylidene-7-methyltridec-4-ene |
|---|---|
| PubChem CID | 143721340 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | (E,8Z)-8-ethylidene-7-methyltridec-4-ene |
| SMILES | C/C=C(/CCCCC)C(C)C/C=C/CCC |
| InChI | InChI=1S/C16H30/c1-5-8-10-12-13-15(4)16(7-3)14-11-9-6-2/h7,10,12,15H,5-6,8-9,11,13-14H2,1-4H3/b12-10+,16-7- |
| InChIKey | SQPQDWVRDJCLLK-RICPEHARSA-N |
| XLogP | 5.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|