C17H16Cl3N3O — CID 143723690
4-(4-chlorophenyl)-4-(2,4-dichloroanilino)-2-iminopentanamide (PubChem CID 143723690) has the molecular formula C17H16Cl3N3O and a molecular weight of 384.69 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-4-(2,4-dichloroanilino)-2-iminopentanamide.
| Compound Name | 4-(4-chlorophenyl)-4-(2,4-dichloroanilino)-2-iminopentanamide |
|---|---|
| PubChem CID | 143723690 |
| Molecular Formula | C17H16Cl3N3O |
| Molecular Weight | 384.69 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 4-(4-chlorophenyl)-4-(2,4-dichloroanilino)-2-iminopentanamide |
| SMILES | [H]/N=C(/CC(C)(Nc1ccc(Cl)cc1Cl)c1ccc(Cl)cc1)C(N)=O |
| InChI | InChI=1S/C17H16Cl3N3O/c1-17(9-14(21)16(22)24,10-2-4-11(18)5-3-10)23-15-7-6-12(19)8-13(15)20/h2-8,21,23H,9H2,1H3,(H2,22,24)/b21-14- |
| InChIKey | ALMJSMTUCWUZQN-STZFKDTASA-N |
| XLogP | 4.87 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.69 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|