C22H30N2O2 — CID 143728473
11-ethyl-5-methoxy-8-methyl-8,16-diazapentacyclo[10.7.1.01,9.02,7.016,20]icosa-2(7),3,5,13-tetraen-10-ol (PubChem CID 143728473) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is 11-ethyl-5-methoxy-8-methyl-8,16-diazapentacyclo[10.7.1.01,9.02,7.016,20]icosa-2(7),3,5,13-tetraen-10-ol.
| Compound Name | 11-ethyl-5-methoxy-8-methyl-8,16-diazapentacyclo[10.7.1.01,9.02,7.016,20]icosa-2(7),3,5,13-tetraen-10-ol |
|---|---|
| PubChem CID | 143728473 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 11-ethyl-5-methoxy-8-methyl-8,16-diazapentacyclo[10.7.1.01,9.02,7.016,20]icosa-2(7),3,5,13-tetraen-10-ol |
| SMILES | CCC1C(O)C2N(C)c3cc(OC)ccc3C23CCCN2CC=CC1C23 |
| InChI | InChI=1S/C22H30N2O2/c1-4-15-16-7-5-11-24-12-6-10-22(20(16)24)17-9-8-14(26-3)13-18(17)23(2)21(22)19(15)25/h5,7-9,13,15-16,19-21,25H,4,6,10-12H2,1-3H3 |
| InChIKey | TYFRSQURFDLJTL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|