C15H17NO — CID 143737496
3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)methyl]-1H-pyrrole (PubChem CID 143737496) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)methyl]-1H-pyrrole.
| Compound Name | 3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)methyl]-1H-pyrrole |
|---|---|
| PubChem CID | 143737496 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)methyl]-1H-pyrrole |
| SMILES | Cc1ccc2c(c1)C(Cc1cc[nH]c1)CCO2 |
| InChI | InChI=1S/C15H17NO/c1-11-2-3-15-14(8-11)13(5-7-17-15)9-12-4-6-16-10-12/h2-4,6,8,10,13,16H,5,7,9H2,1H3 |
| InChIKey | CTPVWRPWZMCLLJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |