About ethane;3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)methyl]-1H-pyrrole;pentan-2-one
ethane;3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)methyl]-1H-pyrrole;pentan-2-one (PubChem CID 143737535) has the molecular formula C22H33NO2
and a molecular weight of 343.51 g/mol. Its IUPAC name is ethane;3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)methyl]-1H-pyrrole;pentan-2-one.
Molecular Properties
| Compound Name | ethane;3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)methyl]-1H-pyrrole;pentan-2-one |
| PubChem CID | 143737535 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | ethane;3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)methyl]-1H-pyrrole;pentan-2-one |
| SMILES | CC.CCCC(C)=O.Cc1ccc2c(c1)C(Cc1cc[nH]c1)CCO2 |
| InChI | InChI=1S/C15H17NO.C5H10O.C2H6/c1-11-2-3-15-14(8-11)13(5-7-17-15)9-12-4-6-16-10-12;1-3-4-5(2)6;1-2/h2-4,6,8,10,13,16H,5,7,9H2,1H3;3-4H2,1-2H3;1-2H3 |
| InChIKey | HFSMDUBQDLKNCG-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)methyl]-1H-pyrrole;pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)methyl]-1H-pyrrole;pentan-2-one?
The IUPAC name of ethane;3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)methyl]-1H-pyrrole;pentan-2-one (CID 143737535) is ethane;3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)methyl]-1H-pyrrole;pentan-2-one.
What is the SMILES notation for ethane;3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)methyl]-1H-pyrrole;pentan-2-one?
The canonical SMILES for ethane;3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)methyl]-1H-pyrrole;pentan-2-one is CC.CCCC(C)=O.Cc1ccc2c(c1)C(Cc1cc[nH]c1)CCO2.
What is the InChIKey of ethane;3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)methyl]-1H-pyrrole;pentan-2-one?
The InChIKey is HFSMDUBQDLKNCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO.C5H10O.C2H6/c1-11-2-3-15-14(8-11)13(5-7-17-15)9-12-4-6-16-10-12;1-3-4-5(2)6;1-2/h2-4,6,8,10,13,16H,5,7,9H2,1H3;3-4H2,1-2H3;1-2H3.
What are the key properties of ethane;3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)methyl]-1H-pyrrole;pentan-2-one?
ethane;3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)methyl]-1H-pyrrole;pentan-2-one has a molecular weight of 343.51 g/mol, XLogP of 5.83, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)methyl]-1H-pyrrole;pentan-2-one is sourced from PubChem (CID 143737535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).