C11H8ClN3O2 — CID 143745769
8-chloro-4,5-dihydro-2H-pyrazolo[3,4-f]isoquinoline-3-carboxylic acid (PubChem CID 143745769) has the molecular formula C11H8ClN3O2 and a molecular weight of 249.66 g/mol. Its IUPAC name is 8-chloro-4,5-dihydro-2H-pyrazolo[3,4-f]isoquinoline-3-carboxylic acid.
| Compound Name | 8-chloro-4,5-dihydro-2H-pyrazolo[3,4-f]isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 143745769 |
| Molecular Formula | C11H8ClN3O2 |
| Molecular Weight | 249.66 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 8-chloro-4,5-dihydro-2H-pyrazolo[3,4-f]isoquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1[nH]nc2c1CCc1cnc(Cl)cc1-2 |
| InChI | InChI=1S/C11H8ClN3O2/c12-8-3-7-5(4-13-8)1-2-6-9(7)14-15-10(6)11(16)17/h3-4H,1-2H2,(H,14,15)(H,16,17) |
| InChIKey | DHUXWRDJNZUMTK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.66 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|