C19H33N3O — CID 143756640
ethane;2-[(1E,3E)-3-ethenyl-2-methylhexa-1,3-dienyl]imino-N'-(2-hydroxyethyl)-N-[(Z)-prop-1-enyl]propanimidamide (PubChem CID 143756640) has the molecular formula C19H33N3O and a molecular weight of 319.49 g/mol. Its IUPAC name is ethane;2-[(1E,3E)-3-ethenyl-2-methylhexa-1,3-dienyl]imino-N'-(2-hydroxyethyl)-N-[(Z)-prop-1-enyl]propanimidamide.
| Compound Name | ethane;2-[(1E,3E)-3-ethenyl-2-methylhexa-1,3-dienyl]imino-N'-(2-hydroxyethyl)-N-[(Z)-prop-1-enyl]propanimidamide |
|---|---|
| PubChem CID | 143756640 |
| Molecular Formula | C19H33N3O |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | ethane;2-[(1E,3E)-3-ethenyl-2-methylhexa-1,3-dienyl]imino-N'-(2-hydroxyethyl)-N-[(Z)-prop-1-enyl]propanimidamide |
| SMILES | C=CC(=C\CC)/C(C)=C/N=C(C)/C(=N/CCO)N/C=C\C.CC |
| InChI | InChI=1S/C17H27N3O.C2H6/c1-6-9-16(8-3)14(4)13-20-15(5)17(18-10-7-2)19-11-12-21;1-2/h7-10,13,21H,3,6,11-12H2,1-2,4-5H3,(H,18,19);1-2H3/b10-7-,14-13+,16-9+,20-15+; |
| InChIKey | NOIIHLLAIANEKN-LGYXOKJOSA-N |
| XLogP | 4.41 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|