C24H23FO3 — CID 143758769
(2R,6S,8R)-8-(4-fluorophenyl)-5-hydroxy-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]dec-4-en-3-one (PubChem CID 143758769) has the molecular formula C24H23FO3 and a molecular weight of 378.44 g/mol. Its IUPAC name is (2R,6S,8R)-8-(4-fluorophenyl)-5-hydroxy-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]dec-4-en-3-one.
| Compound Name | (2R,6S,8R)-8-(4-fluorophenyl)-5-hydroxy-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]dec-4-en-3-one |
|---|---|
| PubChem CID | 143758769 |
| Molecular Formula | C24H23FO3 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (2R,6S,8R)-8-(4-fluorophenyl)-5-hydroxy-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]dec-4-en-3-one |
| SMILES | Cc1cc(C)c(C2=C(O)[C@@H]3C4OC(C[C@@H]4c4ccc(F)cc4)[C@@H]3C2=O)c(C)c1 |
| InChI | InChI=1S/C24H23FO3/c1-11-8-12(2)18(13(3)9-11)20-22(26)19-17-10-16(14-4-6-15(25)7-5-14)24(28-17)21(19)23(20)27/h4-9,16-17,19,21,24,27H,10H2,1-3H3/t16-,17?,19+,21-,24?/m1/s1 |
| InChIKey | QCTUGAFSFMQNBG-GIBLQAGHSA-N |
| XLogP | 4.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |