C20H18N2O2 — CID 143762353
methyl 4-(4-cyanophenyl)-2,2-dimethylchromene-6-carboximidate (PubChem CID 143762353) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is methyl 4-(4-cyanophenyl)-2,2-dimethylchromene-6-carboximidate.
| Compound Name | methyl 4-(4-cyanophenyl)-2,2-dimethylchromene-6-carboximidate |
|---|---|
| PubChem CID | 143762353 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | methyl 4-(4-cyanophenyl)-2,2-dimethylchromene-6-carboximidate |
| SMILES | [H]/N=C(\OC)c1ccc2c(c1)C(c1ccc(C#N)cc1)=CC(C)(C)O2 |
| InChI | InChI=1S/C20H18N2O2/c1-20(2)11-17(14-6-4-13(12-21)5-7-14)16-10-15(19(22)23-3)8-9-18(16)24-20/h4-11,22H,1-3H3/b22-19- |
| InChIKey | HGYPAIRFDZEHII-QOCHGBHMSA-N |
| XLogP | 4.13 |
| TPSA | 66.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|