C26H38O6 — CID 143762961
ethane;(9E,17R)-11-hydroperoxy-7-(1-hydroxyprop-2-enyl)-15-methyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-9,19-dien-3-yn-5-one (PubChem CID 143762961) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is ethane;(9E,17R)-11-hydroperoxy-7-(1-hydroxyprop-2-enyl)-15-methyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-9,19-dien-3-yn-5-one.
| Compound Name | ethane;(9E,17R)-11-hydroperoxy-7-(1-hydroxyprop-2-enyl)-15-methyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-9,19-dien-3-yn-5-one |
|---|---|
| PubChem CID | 143762961 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | ethane;(9E,17R)-11-hydroperoxy-7-(1-hydroxyprop-2-enyl)-15-methyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-9,19-dien-3-yn-5-one |
| SMILES | C=CC(O)C1C/C=C/C(OO)CC(=C)CC(C)C[C@@H]2CC=CC(CC#CC(=O)O1)O2.CC |
| InChI | InChI=1S/C24H32O6.C2H6/c1-4-22(25)23-12-6-11-21(30-27)16-18(3)14-17(2)15-20-10-5-8-19(28-20)9-7-13-24(26)29-23;1-2/h4-6,8,11,17,19-23,25,27H,1,3,9-10,12,14-16H2,2H3;1-2H3/b11-6+;/t17?,19?,20-,21?,22?,23?;/m0./s1 |
| InChIKey | ZINMUHUVRFDPKL-QJVXQLGUSA-N |
| XLogP | 4.76 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|