C6H8N2O — CID 143762993
5-(2-methylprop-2-enyl)-1,2,4-oxadiazole (PubChem CID 143762993) has the molecular formula C6H8N2O and a molecular weight of 124.14 g/mol. Its IUPAC name is 5-(2-methylprop-2-enyl)-1,2,4-oxadiazole.
| Compound Name | 5-(2-methylprop-2-enyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 143762993 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | 5-(2-methylprop-2-enyl)-1,2,4-oxadiazole |
| SMILES | C=C(C)Cc1ncno1 |
| InChI | InChI=1S/C6H8N2O/c1-5(2)3-6-7-4-8-9-6/h4H,1,3H2,2H3 |
| InChIKey | DBPWPHCYUIFAET-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|