C18H27ClO2 — CID 143768979
(7R,8R)-8-(3-chloropropyl)-7-methyl-6,7,8,9-tetrahydrobenzo[g][1,3]benzodioxole;propane (PubChem CID 143768979) has the molecular formula C18H27ClO2 and a molecular weight of 310.87 g/mol. Its IUPAC name is (7R,8R)-8-(3-chloropropyl)-7-methyl-6,7,8,9-tetrahydrobenzo[g][1,3]benzodioxole;propane.
| Compound Name | (7R,8R)-8-(3-chloropropyl)-7-methyl-6,7,8,9-tetrahydrobenzo[g][1,3]benzodioxole;propane |
|---|---|
| PubChem CID | 143768979 |
| Molecular Formula | C18H27ClO2 |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (7R,8R)-8-(3-chloropropyl)-7-methyl-6,7,8,9-tetrahydrobenzo[g][1,3]benzodioxole;propane |
| SMILES | CCC.C[C@@H]1Cc2ccc3c(c2C[C@H]1CCCCl)OCO3 |
| InChI | InChI=1S/C15H19ClO2.C3H8/c1-10-7-12-4-5-14-15(18-9-17-14)13(12)8-11(10)3-2-6-16;1-3-2/h4-5,10-11H,2-3,6-9H2,1H3;3H2,1-2H3/t10-,11-;/m1./s1 |
| InChIKey | BMTMFFZDTZTBPZ-NDXYWBNTSA-N |
| XLogP | 5.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|