C28H35F3O2 — CID 143772705
1-[[(3E,7Z,11Z)-13-ethoxy-3,11,12-trifluoro-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaen-2-yl]oxymethyl]-4-methylcyclohexane (PubChem CID 143772705) has the molecular formula C28H35F3O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 1-[[(3E,7Z,11Z)-13-ethoxy-3,11,12-trifluoro-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaen-2-yl]oxymethyl]-4-methylcyclohexane.
| Compound Name | 1-[[(3E,7Z,11Z)-13-ethoxy-3,11,12-trifluoro-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaen-2-yl]oxymethyl]-4-methylcyclohexane |
|---|---|
| PubChem CID | 143772705 |
| Molecular Formula | C28H35F3O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 1-[[(3E,7Z,11Z)-13-ethoxy-3,11,12-trifluoro-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaen-2-yl]oxymethyl]-4-methylcyclohexane |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(F)=C(\F)C(=C)OCC)C(=C)/C=C(/F)C(=C)OCC1CCC(C)CC1 |
| InChI | InChI=1S/C28H35F3O2/c1-9-32-24(8)28(31)27(30)22(6)20(4)13-12-19(3)21(5)16-26(29)23(7)33-17-25-14-10-18(2)11-15-25/h12-13,16,18,25H,3-11,14-15,17H2,1-2H3/b13-12-,26-16+,28-27- |
| InChIKey | IKHHKDAWISFVAV-KTDWQDMPSA-N |
| XLogP | 8.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|