C40H50F4 — CID 143772969
1-[4-(5,6-difluoro-4-octylcyclohexa-1,3-dien-1-yl)phenyl]-4-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-5,6-difluorocyclohexa-1,3-diene (PubChem CID 143772969) has the molecular formula C40H50F4 and a molecular weight of 606.83 g/mol. Its IUPAC name is 1-[4-(5,6-difluoro-4-octylcyclohexa-1,3-dien-1-yl)phenyl]-4-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-5,6-difluorocyclohexa-1,3-diene.
| Compound Name | 1-[4-(5,6-difluoro-4-octylcyclohexa-1,3-dien-1-yl)phenyl]-4-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-5,6-difluorocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143772969 |
| Molecular Formula | C40H50F4 |
| Molecular Weight | 606.83 g/mol |
| Exact Mass | 606.38 |
| IUPAC Name | 1-[4-(5,6-difluoro-4-octylcyclohexa-1,3-dien-1-yl)phenyl]-4-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-5,6-difluorocyclohexa-1,3-diene |
| SMILES | C=CC1CCC(C2CC=C(C3=CC=C(c4ccc(C5=CC=C(CCCCCCCC)C(F)C5F)cc4)C(F)C3F)CC2)CC1 |
| InChI | InChI=1S/C40H50F4/c1-3-5-6-7-8-9-10-33-23-24-34(38(42)37(33)41)31-19-21-32(22-20-31)36-26-25-35(39(43)40(36)44)30-17-15-29(16-18-30)28-13-11-27(4-2)12-14-28/h4,17,19-29,37-40H,2-3,5-16,18H2,1H3 |
| InChIKey | QOULTAXZIDFNDO-UHFFFAOYSA-N |
| XLogP | 12.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.83 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|