C41H52F4 — CID 143773050
1-[4-(5,6-difluoro-4-octylcyclohexa-1,3-dien-1-yl)phenyl]-5,6-difluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexen-1-yl]cyclohexa-1,3-diene (PubChem CID 143773050) has the molecular formula C41H52F4 and a molecular weight of 620.86 g/mol. Its IUPAC name is 1-[4-(5,6-difluoro-4-octylcyclohexa-1,3-dien-1-yl)phenyl]-5,6-difluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexen-1-yl]cyclohexa-1,3-diene.
| Compound Name | 1-[4-(5,6-difluoro-4-octylcyclohexa-1,3-dien-1-yl)phenyl]-5,6-difluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexen-1-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143773050 |
| Molecular Formula | C41H52F4 |
| Molecular Weight | 620.86 g/mol |
| Exact Mass | 620.40 |
| IUPAC Name | 1-[4-(5,6-difluoro-4-octylcyclohexa-1,3-dien-1-yl)phenyl]-5,6-difluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexen-1-yl]cyclohexa-1,3-diene |
| SMILES | C/C=C/C1CCC(C2CC=C(C3=CC=C(c4ccc(C5=CC=C(CCCCCCCC)C(F)C5F)cc4)C(F)C3F)CC2)CC1 |
| InChI | InChI=1S/C41H52F4/c1-3-5-6-7-8-9-11-34-24-25-35(39(43)38(34)42)32-20-22-33(23-21-32)37-27-26-36(40(44)41(37)45)31-18-16-30(17-19-31)29-14-12-28(10-4-2)13-15-29/h4,10,18,20-30,38-41H,3,5-9,11-17,19H2,1-2H3/b10-4+ |
| InChIKey | FPJWSGXNYQJEHY-ONNFQVAWSA-N |
| XLogP | 12.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.86 |
| LogP ≤ 5 | 12.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|