C40H48F4 — CID 89045993
1-[4-[(2Z,4Z)-4,5-difluoro-6-methylidenedodeca-2,4-dien-3-yl]phenyl]-2,3-difluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexen-1-yl]benzene (PubChem CID 89045993) has the molecular formula C40H48F4 and a molecular weight of 604.82 g/mol. Its IUPAC name is 1-[4-[(2Z,4Z)-4,5-difluoro-6-methylidenedodeca-2,4-dien-3-yl]phenyl]-2,3-difluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexen-1-yl]benzene.
| Compound Name | 1-[4-[(2Z,4Z)-4,5-difluoro-6-methylidenedodeca-2,4-dien-3-yl]phenyl]-2,3-difluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexen-1-yl]benzene |
|---|---|
| PubChem CID | 89045993 |
| Molecular Formula | C40H48F4 |
| Molecular Weight | 604.82 g/mol |
| Exact Mass | 604.37 |
| IUPAC Name | 1-[4-[(2Z,4Z)-4,5-difluoro-6-methylidenedodeca-2,4-dien-3-yl]phenyl]-2,3-difluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexen-1-yl]benzene |
| SMILES | C=C(CCCCCC)/C(F)=C(F)\C(=C/C)c1ccc(-c2ccc(C3=CCC(C4CCC(/C=C/C)CC4)CC3)c(F)c2F)cc1 |
| InChI | InChI=1S/C40H48F4/c1-5-8-9-10-12-27(4)37(41)38(42)34(7-3)31-21-23-33(24-22-31)36-26-25-35(39(43)40(36)44)32-19-17-30(18-20-32)29-15-13-28(11-6-2)14-16-29/h6-7,11,19,21-26,28-30H,4-5,8-10,12-18,20H2,1-3H3/b11-6+,34-7-,38-37- |
| InChIKey | OERIZGDQDJZMSM-ZWQLVQDOSA-N |
| XLogP | 13.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.82 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|