C38H46F4 — CID 89045836
1-[4-[(2Z,4Z)-4,5-difluoro-6-methylocta-2,4-dien-3-yl]phenyl]-2,3-difluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexen-1-yl]benzene (PubChem CID 89045836) has the molecular formula C38H46F4 and a molecular weight of 578.78 g/mol. Its IUPAC name is 1-[4-[(2Z,4Z)-4,5-difluoro-6-methylocta-2,4-dien-3-yl]phenyl]-2,3-difluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexen-1-yl]benzene.
| Compound Name | 1-[4-[(2Z,4Z)-4,5-difluoro-6-methylocta-2,4-dien-3-yl]phenyl]-2,3-difluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexen-1-yl]benzene |
|---|---|
| PubChem CID | 89045836 |
| Molecular Formula | C38H46F4 |
| Molecular Weight | 578.78 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | 1-[4-[(2Z,4Z)-4,5-difluoro-6-methylocta-2,4-dien-3-yl]phenyl]-2,3-difluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexen-1-yl]benzene |
| SMILES | C/C=C(C(\F)=C(\F)C(C)CC)/c1ccc(-c2ccc(C3=CCC(C4CCC(CC/C=C/C)CC4)CC3)c(F)c2F)cc1 |
| InChI | InChI=1S/C38H46F4/c1-5-8-9-10-26-11-13-27(14-12-26)28-15-17-30(18-16-28)33-23-24-34(38(42)37(33)41)31-21-19-29(20-22-31)32(7-3)36(40)35(39)25(4)6-2/h5,7-8,17,19-28H,6,9-16,18H2,1-4H3/b8-5+,32-7-,36-35- |
| InChIKey | AYQOMOQXWPCZGY-XJIXQHHCSA-N |
| XLogP | 12.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.78 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|