C12H20N4 — CID 143775302
N-(4-aminoanilino)-N',2,2-trimethylpropanimidamide (PubChem CID 143775302) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is N-(4-aminoanilino)-N',2,2-trimethylpropanimidamide.
| Compound Name | N-(4-aminoanilino)-N',2,2-trimethylpropanimidamide |
|---|---|
| PubChem CID | 143775302 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | N-(4-aminoanilino)-N',2,2-trimethylpropanimidamide |
| SMILES | C/N=C(/NNc1ccc(N)cc1)C(C)(C)C |
| InChI | InChI=1S/C12H20N4/c1-12(2,3)11(14-4)16-15-10-7-5-9(13)6-8-10/h5-8,15H,13H2,1-4H3,(H,14,16) |
| InChIKey | KXWYZQGJUXBGFK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|