C34H47NO6 — CID 143775427
2-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)pent-2-enoyl]oxyethoxy]ethyl non-8-enoate;(3Z,5Z)-hepta-1,3,5-triene (PubChem CID 143775427) has the molecular formula C34H47NO6 and a molecular weight of 565.75 g/mol. Its IUPAC name is 2-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)pent-2-enoyl]oxyethoxy]ethyl non-8-enoate;(3Z,5Z)-hepta-1,3,5-triene.
| Compound Name | 2-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)pent-2-enoyl]oxyethoxy]ethyl non-8-enoate;(3Z,5Z)-hepta-1,3,5-triene |
|---|---|
| PubChem CID | 143775427 |
| Molecular Formula | C34H47NO6 |
| Molecular Weight | 565.75 g/mol |
| Exact Mass | 565.34 |
| IUPAC Name | 2-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)pent-2-enoyl]oxyethoxy]ethyl non-8-enoate;(3Z,5Z)-hepta-1,3,5-triene |
| SMILES | C=C/C=C\C=C/C.C=CCCCCCCC(=O)OCCOCCOC(=O)/C(C#N)=C(\CC)c1ccc(OCC)cc1 |
| InChI | InChI=1S/C27H37NO6.C7H10/c1-4-7-8-9-10-11-12-26(29)33-19-17-31-18-20-34-27(30)25(21-28)24(5-2)22-13-15-23(16-14-22)32-6-3;1-3-5-7-6-4-2/h4,13-16H,1,5-12,17-20H2,2-3H3;3-7H,1H2,2H3/b25-24+;6-4-,7-5- |
| InChIKey | ITVSZOPCCRCAOK-WKNWSXHSSA-N |
| XLogP | 7.71 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.75 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|