About 2-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)pent-2-enoyl]oxyethoxy]ethyl non-8-enoate
2-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)pent-2-enoyl]oxyethoxy]ethyl non-8-enoate (PubChem CID 143775428) has the molecular formula C27H37NO6
and a molecular weight of 471.59 g/mol. Its IUPAC name is 2-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)pent-2-enoyl]oxyethoxy]ethyl non-8-enoate.
Molecular Properties
| Compound Name | 2-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)pent-2-enoyl]oxyethoxy]ethyl non-8-enoate |
| PubChem CID | 143775428 |
| Molecular Formula | C27H37NO6 |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 2-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)pent-2-enoyl]oxyethoxy]ethyl non-8-enoate |
| SMILES | C=CCCCCCCC(=O)OCCOCCOC(=O)/C(C#N)=C(\CC)c1ccc(OCC)cc1 |
| InChI | InChI=1S/C27H37NO6/c1-4-7-8-9-10-11-12-26(29)33-19-17-31-18-20-34-27(30)25(21-28)24(5-2)22-13-15-23(16-14-22)32-6-3/h4,13-16H,1,5-12,17-20H2,2-3H3/b25-24+ |
| InChIKey | ABJJIPQUVGBIES-OCOZRVBESA-N |
| XLogP | 5.40 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)pent-2-enoyl]oxyethoxy]ethyl non-8-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)pent-2-enoyl]oxyethoxy]ethyl non-8-enoate?
The IUPAC name of 2-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)pent-2-enoyl]oxyethoxy]ethyl non-8-enoate (CID 143775428) is 2-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)pent-2-enoyl]oxyethoxy]ethyl non-8-enoate.
What is the SMILES notation for 2-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)pent-2-enoyl]oxyethoxy]ethyl non-8-enoate?
The canonical SMILES for 2-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)pent-2-enoyl]oxyethoxy]ethyl non-8-enoate is C=CCCCCCCC(=O)OCCOCCOC(=O)/C(C#N)=C(\CC)c1ccc(OCC)cc1.
What is the InChIKey of 2-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)pent-2-enoyl]oxyethoxy]ethyl non-8-enoate?
The InChIKey is ABJJIPQUVGBIES-OCOZRVBESA-N. The full InChI is InChI=1S/C27H37NO6/c1-4-7-8-9-10-11-12-26(29)33-19-17-31-18-20-34-27(30)25(21-28)24(5-2)22-13-15-23(16-14-22)32-6-3/h4,13-16H,1,5-12,17-20H2,2-3H3/b25-24+.
What are the key properties of 2-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)pent-2-enoyl]oxyethoxy]ethyl non-8-enoate?
2-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)pent-2-enoyl]oxyethoxy]ethyl non-8-enoate has a molecular weight of 471.59 g/mol, XLogP of 5.40, 18 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)pent-2-enoyl]oxyethoxy]ethyl non-8-enoate is sourced from PubChem (CID 143775428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).