C22H24FN7O — CID 143777674
6-amino-7-fluoro-8-(3-imidazol-1-ylpropylamino)-4-oxospiro[1,10-diazatricyclo[7.4.1.05,14]tetradeca-2,5,7,9(14)-tetraene-13,1'-cyclobutane]-3-carbonitrile (PubChem CID 143777674) has the molecular formula C22H24FN7O and a molecular weight of 421.48 g/mol. Its IUPAC name is 6-amino-7-fluoro-8-(3-imidazol-1-ylpropylamino)-4-oxospiro[1,10-diazatricyclo[7.4.1.05,14]tetradeca-2,5,7,9(14)-tetraene-13,1'-cyclobutane]-3-carbonitrile.
| Compound Name | 6-amino-7-fluoro-8-(3-imidazol-1-ylpropylamino)-4-oxospiro[1,10-diazatricyclo[7.4.1.05,14]tetradeca-2,5,7,9(14)-tetraene-13,1'-cyclobutane]-3-carbonitrile |
|---|---|
| PubChem CID | 143777674 |
| Molecular Formula | C22H24FN7O |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 6-amino-7-fluoro-8-(3-imidazol-1-ylpropylamino)-4-oxospiro[1,10-diazatricyclo[7.4.1.05,14]tetradeca-2,5,7,9(14)-tetraene-13,1'-cyclobutane]-3-carbonitrile |
| SMILES | N#Cc1cn2c3c(c(NCCCn4ccnc4)c(F)c(N)c3c1=O)NCCC21CCC1 |
| InChI | InChI=1S/C22H24FN7O/c23-16-17(25)15-20-19(18(16)27-6-2-9-29-10-8-26-13-29)28-7-5-22(3-1-4-22)30(20)12-14(11-24)21(15)31/h8,10,12-13,27-28H,1-7,9,25H2 |
| InChIKey | FRPJFVUJBALHSE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|