C19H28N2O6 — CID 143778517
2-[(2-aminoacetyl)amino]-3-[2,6-di(propan-2-yl)phenoxy]carbonyloxybutanoic acid (PubChem CID 143778517) has the molecular formula C19H28N2O6 and a molecular weight of 380.44 g/mol. Its IUPAC name is 2-[(2-aminoacetyl)amino]-3-[2,6-di(propan-2-yl)phenoxy]carbonyloxybutanoic acid.
| Compound Name | 2-[(2-aminoacetyl)amino]-3-[2,6-di(propan-2-yl)phenoxy]carbonyloxybutanoic acid |
|---|---|
| PubChem CID | 143778517 |
| Molecular Formula | C19H28N2O6 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 2-[(2-aminoacetyl)amino]-3-[2,6-di(propan-2-yl)phenoxy]carbonyloxybutanoic acid |
| SMILES | CC(C)c1cccc(C(C)C)c1OC(=O)OC(C)C(NC(=O)CN)C(=O)O |
| InChI | InChI=1S/C19H28N2O6/c1-10(2)13-7-6-8-14(11(3)4)17(13)27-19(25)26-12(5)16(18(23)24)21-15(22)9-20/h6-8,10-12,16H,9,20H2,1-5H3,(H,21,22)(H,23,24) |
| InChIKey | RNHSNNRDTZTYHM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|