C27H31F4N7O4 — CID 143779790
N'-(2-aminoanilino)-2-(2-fluoro-4,5-dimethoxyphenyl)-2-[4-methanimidoyl-3-(methylaminomethyl)anilino]ethanimidamide;2,2,2-trifluoroacetic acid (PubChem CID 143779790) has the molecular formula C27H31F4N7O4 and a molecular weight of 593.58 g/mol. Its IUPAC name is N'-(2-aminoanilino)-2-(2-fluoro-4,5-dimethoxyphenyl)-2-[4-methanimidoyl-3-(methylaminomethyl)anilino]ethanimidamide;2,2,2-trifluoroacetic acid.
| Compound Name | N'-(2-aminoanilino)-2-(2-fluoro-4,5-dimethoxyphenyl)-2-[4-methanimidoyl-3-(methylaminomethyl)anilino]ethanimidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 143779790 |
| Molecular Formula | C27H31F4N7O4 |
| Molecular Weight | 593.58 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | N'-(2-aminoanilino)-2-(2-fluoro-4,5-dimethoxyphenyl)-2-[4-methanimidoyl-3-(methylaminomethyl)anilino]ethanimidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C/c1ccc(NC(/C(N)=N/Nc2ccccc2N)c2cc(OC)c(OC)cc2F)cc1CNC |
| InChI | InChI=1S/C25H30FN7O2.C2HF3O2/c1-30-14-16-10-17(9-8-15(16)13-27)31-24(18-11-22(34-2)23(35-3)12-19(18)26)25(29)33-32-21-7-5-4-6-20(21)28;3-2(4,5)1(6)7/h4-13,24,27,30-32H,14,28H2,1-3H3,(H2,29,33);(H,6,7)/b27-13+; |
| InChIKey | VNWAXMHVIUUYHG-LPUIDCEHSA-N |
| XLogP | 4.31 |
| TPSA | 180.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|