C21H29N2O2S2+ — CID 143781431
methyl-[(1Z,3Z)-3-[(E)-2-[4-[methyl-[2-(4-oxo-4-sulfanylbutanoyl)sulfanylethyl]amino]phenyl]ethenyl]penta-1,3-dienyl]azanium (PubChem CID 143781431) has the molecular formula C21H29N2O2S2+ and a molecular weight of 405.61 g/mol. Its IUPAC name is methyl-[(1Z,3Z)-3-[(E)-2-[4-[methyl-[2-(4-oxo-4-sulfanylbutanoyl)sulfanylethyl]amino]phenyl]ethenyl]penta-1,3-dienyl]azanium.
| Compound Name | methyl-[(1Z,3Z)-3-[(E)-2-[4-[methyl-[2-(4-oxo-4-sulfanylbutanoyl)sulfanylethyl]amino]phenyl]ethenyl]penta-1,3-dienyl]azanium |
|---|---|
| PubChem CID | 143781431 |
| Molecular Formula | C21H29N2O2S2+ |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | methyl-[(1Z,3Z)-3-[(E)-2-[4-[methyl-[2-(4-oxo-4-sulfanylbutanoyl)sulfanylethyl]amino]phenyl]ethenyl]penta-1,3-dienyl]azanium |
| SMILES | C/C=C(\C=C/[NH2+]C)/C=C/c1ccc(N(C)CCSC(=O)CCC(=O)S)cc1 |
| InChI | InChI=1S/C21H28N2O2S2/c1-4-17(13-14-22-2)5-6-18-7-9-19(10-8-18)23(3)15-16-27-21(25)12-11-20(24)26/h4-10,13-14,22H,11-12,15-16H2,1-3H3,(H,24,26)/p+1/b6-5+,14-13-,17-4- |
| InChIKey | QPABYJOEEVRBCO-SPTYLFBBSA-O |
| XLogP | 3.29 |
| TPSA | 53.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|