C26H31N3S2+2 — CID 163477655
methyl-[3-[2-[4-[methyl-[2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)sulfanyl]ethyl]amino]phenyl]ethenyl]hexa-1,3,5-trienyl]azanium (PubChem CID 163477655) has the molecular formula C26H31N3S2+2 and a molecular weight of 449.69 g/mol. Its IUPAC name is methyl-[3-[2-[4-[methyl-[2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)sulfanyl]ethyl]amino]phenyl]ethenyl]hexa-1,3,5-trienyl]azanium.
| Compound Name | methyl-[3-[2-[4-[methyl-[2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)sulfanyl]ethyl]amino]phenyl]ethenyl]hexa-1,3,5-trienyl]azanium |
|---|---|
| PubChem CID | 163477655 |
| Molecular Formula | C26H31N3S2+2 |
| Molecular Weight | 449.69 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | methyl-[3-[2-[4-[methyl-[2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)sulfanyl]ethyl]amino]phenyl]ethenyl]hexa-1,3,5-trienyl]azanium |
| SMILES | C=CC=C(C=C[NH2+]C)C=Cc1ccc(N(C)CCSc2sc3ccccc3[n+]2C)cc1 |
| InChI | InChI=1S/C26H30N3S2/c1-5-8-21(17-18-27-2)11-12-22-13-15-23(16-14-22)28(3)19-20-30-26-29(4)24-9-6-7-10-25(24)31-26/h5-18,27H,1,19-20H2,2-4H3/q+1/p+1 |
| InChIKey | CBVCEKATSBYYAQ-UHFFFAOYSA-O |
| XLogP | 4.79 |
| TPSA | 23.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.69 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|