C15H20N3+ — CID 143819841
methyl-[(1Z,3E)-3-[(E)-[methyl(phenyl)hydrazinylidene]methyl]hexa-1,3,5-trienyl]azanium (PubChem CID 143819841) has the molecular formula C15H20N3+ and a molecular weight of 242.35 g/mol. Its IUPAC name is methyl-[(1Z,3E)-3-[(E)-[methyl(phenyl)hydrazinylidene]methyl]hexa-1,3,5-trienyl]azanium.
| Compound Name | methyl-[(1Z,3E)-3-[(E)-[methyl(phenyl)hydrazinylidene]methyl]hexa-1,3,5-trienyl]azanium |
|---|---|
| PubChem CID | 143819841 |
| Molecular Formula | C15H20N3+ |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | methyl-[(1Z,3E)-3-[(E)-[methyl(phenyl)hydrazinylidene]methyl]hexa-1,3,5-trienyl]azanium |
| SMILES | C=C/C=C(\C=C/[NH2+]C)/C=N/N(C)c1ccccc1 |
| InChI | InChI=1S/C15H19N3/c1-4-8-14(11-12-16-2)13-17-18(3)15-9-6-5-7-10-15/h4-13,16H,1H2,2-3H3/p+1/b12-11-,14-8+,17-13+ |
| InChIKey | NAUTVWBTVMGDAD-AWRZGFHJSA-O |
| XLogP | 1.93 |
| TPSA | 32.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|