C23H24N6 — CID 18531202
N-[(E)-[(2E,3E)-2,3-bis[methyl(phenyl)hydrazinylidene]propylidene]amino]aniline (PubChem CID 18531202) has the molecular formula C23H24N6 and a molecular weight of 384.49 g/mol. Its IUPAC name is N-[(E)-[(2E,3E)-2,3-bis[methyl(phenyl)hydrazinylidene]propylidene]amino]aniline.
| Compound Name | N-[(E)-[(2E,3E)-2,3-bis[methyl(phenyl)hydrazinylidene]propylidene]amino]aniline |
|---|---|
| PubChem CID | 18531202 |
| Molecular Formula | C23H24N6 |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | N-[(E)-[(2E,3E)-2,3-bis[methyl(phenyl)hydrazinylidene]propylidene]amino]aniline |
| SMILES | CN(/N=C/C(/C=N/Nc1ccccc1)=N/N(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24N6/c1-28(22-14-8-4-9-15-22)25-19-21(18-24-26-20-12-6-3-7-13-20)27-29(2)23-16-10-5-11-17-23/h3-19,26H,1-2H3/b24-18+,25-19+,27-21+ |
| InChIKey | YKJBLFNLWXENGX-HGJJJYCWSA-N |
| XLogP | 4.70 |
| TPSA | 55.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|