C34H46N4O5S — CID 143782420
methyl N-[1-[[7-[(4-aminophenyl)sulfinyl-propylamino]-8-hydroxyoctan-3-yl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate (PubChem CID 143782420) has the molecular formula C34H46N4O5S and a molecular weight of 622.83 g/mol. Its IUPAC name is methyl N-[1-[[7-[(4-aminophenyl)sulfinyl-propylamino]-8-hydroxyoctan-3-yl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate.
| Compound Name | methyl N-[1-[[7-[(4-aminophenyl)sulfinyl-propylamino]-8-hydroxyoctan-3-yl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 143782420 |
| Molecular Formula | C34H46N4O5S |
| Molecular Weight | 622.83 g/mol |
| Exact Mass | 622.32 |
| IUPAC Name | methyl N-[1-[[7-[(4-aminophenyl)sulfinyl-propylamino]-8-hydroxyoctan-3-yl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate |
| SMILES | CCCN(C(CO)CCCC(CC)NC(=O)C(NC(=O)OC)C(c1ccccc1)c1ccccc1)S(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C34H46N4O5S/c1-4-23-38(44(42)30-21-19-27(35)20-22-30)29(24-39)18-12-17-28(5-2)36-33(40)32(37-34(41)43-3)31(25-13-8-6-9-14-25)26-15-10-7-11-16-26/h6-11,13-16,19-22,28-29,31-32,39H,4-5,12,17-18,23-24,35H2,1-3H3,(H,36,40)(H,37,41) |
| InChIKey | GAMMJKRPRCMJMY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.83 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|