About cyclopropane;3-(3-iodosulfanyloxyphenyl)propanoic acid
cyclopropane;3-(3-iodosulfanyloxyphenyl)propanoic acid (PubChem CID 143789205) has the molecular formula C12H15IO3S
and a molecular weight of 366.22 g/mol. Its IUPAC name is cyclopropane;3-(3-iodosulfanyloxyphenyl)propanoic acid.
Molecular Properties
| Compound Name | cyclopropane;3-(3-iodosulfanyloxyphenyl)propanoic acid |
| PubChem CID | 143789205 |
| Molecular Formula | C12H15IO3S |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | cyclopropane;3-(3-iodosulfanyloxyphenyl)propanoic acid |
| SMILES | C1CC1.O=C(O)CCc1cccc(OSI)c1 |
| InChI | InChI=1S/C9H9IO3S.C3H6/c10-14-13-8-3-1-2-7(6-8)4-5-9(11)12;1-2-3-1/h1-3,6H,4-5H2,(H,11,12);1-3H2 |
| InChIKey | SLMMQZXTHXQNPI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclopropane;3-(3-iodosulfanyloxyphenyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropane;3-(3-iodosulfanyloxyphenyl)propanoic acid?
The IUPAC name of cyclopropane;3-(3-iodosulfanyloxyphenyl)propanoic acid (CID 143789205) is cyclopropane;3-(3-iodosulfanyloxyphenyl)propanoic acid.
What is the SMILES notation for cyclopropane;3-(3-iodosulfanyloxyphenyl)propanoic acid?
The canonical SMILES for cyclopropane;3-(3-iodosulfanyloxyphenyl)propanoic acid is C1CC1.O=C(O)CCc1cccc(OSI)c1.
What is the InChIKey of cyclopropane;3-(3-iodosulfanyloxyphenyl)propanoic acid?
The InChIKey is SLMMQZXTHXQNPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9IO3S.C3H6/c10-14-13-8-3-1-2-7(6-8)4-5-9(11)12;1-2-3-1/h1-3,6H,4-5H2,(H,11,12);1-3H2.
What are the key properties of cyclopropane;3-(3-iodosulfanyloxyphenyl)propanoic acid?
cyclopropane;3-(3-iodosulfanyloxyphenyl)propanoic acid has a molecular weight of 366.22 g/mol, XLogP of 4.25, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropane;3-(3-iodosulfanyloxyphenyl)propanoic acid is sourced from PubChem (CID 143789205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).