C11H15N3 — CID 143789552
2-N,3-N-bis(ethenyl)pyridine-2,3-diimine;ethane (PubChem CID 143789552) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-N,3-N-bis(ethenyl)pyridine-2,3-diimine;ethane.
| Compound Name | 2-N,3-N-bis(ethenyl)pyridine-2,3-diimine;ethane |
|---|---|
| PubChem CID | 143789552 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 2-N,3-N-bis(ethenyl)pyridine-2,3-diimine;ethane |
| SMILES | C=C/N=C1\N=CC=C\C1=N/C=C.CC |
| InChI | InChI=1S/C9H9N3.C2H6/c1-3-10-8-6-5-7-12-9(8)11-4-2;1-2/h3-7H,1-2H2;1-2H3/b10-8+,11-9-; |
| InChIKey | VWWPYKOHZCWDET-OWUJXOTASA-N |
| XLogP | 2.78 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|