About 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine;ethane
2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine;ethane (PubChem CID 143791133) has the molecular formula C9H14N4
and a molecular weight of 178.24 g/mol. Its IUPAC name is 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine;ethane.
Analyze 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine;ethane?
The IUPAC name of 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine;ethane (CID 143791133) is 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine;ethane.
What is the SMILES notation for 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine;ethane?
The canonical SMILES for 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine;ethane is CC.Cc1ccn2nc(C)nc2n1.
What is the InChIKey of 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine;ethane?
The InChIKey is IQKGROUFPPMQNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4.C2H6/c1-5-3-4-11-7(8-5)9-6(2)10-11;1-2/h3-4H,1-2H3;1-2H3.
What are the key properties of 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine;ethane?
2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine;ethane has a molecular weight of 178.24 g/mol, XLogP of 1.77, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine;ethane is sourced from PubChem (CID 143791133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).