About N,N,2,5-tetramethylpyrazolo[1,5-a]pyrimidin-3-amine
N,N,2,5-tetramethylpyrazolo[1,5-a]pyrimidin-3-amine (PubChem CID 69492586) has the molecular formula C10H14N4
and a molecular weight of 190.25 g/mol. Its IUPAC name is N,N,2,5-tetramethylpyrazolo[1,5-a]pyrimidin-3-amine.
Analyze N,N,2,5-tetramethylpyrazolo[1,5-a]pyrimidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,2,5-tetramethylpyrazolo[1,5-a]pyrimidin-3-amine?
The IUPAC name of N,N,2,5-tetramethylpyrazolo[1,5-a]pyrimidin-3-amine (CID 69492586) is N,N,2,5-tetramethylpyrazolo[1,5-a]pyrimidin-3-amine.
What is the SMILES notation for N,N,2,5-tetramethylpyrazolo[1,5-a]pyrimidin-3-amine?
The canonical SMILES for N,N,2,5-tetramethylpyrazolo[1,5-a]pyrimidin-3-amine is Cc1ccn2nc(C)c(N(C)C)c2n1.
What is the InChIKey of N,N,2,5-tetramethylpyrazolo[1,5-a]pyrimidin-3-amine?
The InChIKey is YGMBUJKDMFABKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4/c1-7-5-6-14-10(11-7)9(13(3)4)8(2)12-14/h5-6H,1-4H3.
What are the key properties of N,N,2,5-tetramethylpyrazolo[1,5-a]pyrimidin-3-amine?
N,N,2,5-tetramethylpyrazolo[1,5-a]pyrimidin-3-amine has a molecular weight of 190.25 g/mol, XLogP of 1.41, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,2,5-tetramethylpyrazolo[1,5-a]pyrimidin-3-amine is sourced from PubChem (CID 69492586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).