C28H29N — CID 143792896
N-methyl-1-[(1E)-3-methylidene-1-phenyl-4-prop-2-enylhepta-1,6-dien-4-yl]naphthalen-2-amine (PubChem CID 143792896) has the molecular formula C28H29N and a molecular weight of 379.55 g/mol. Its IUPAC name is N-methyl-1-[(1E)-3-methylidene-1-phenyl-4-prop-2-enylhepta-1,6-dien-4-yl]naphthalen-2-amine.
| Compound Name | N-methyl-1-[(1E)-3-methylidene-1-phenyl-4-prop-2-enylhepta-1,6-dien-4-yl]naphthalen-2-amine |
|---|---|
| PubChem CID | 143792896 |
| Molecular Formula | C28H29N |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | N-methyl-1-[(1E)-3-methylidene-1-phenyl-4-prop-2-enylhepta-1,6-dien-4-yl]naphthalen-2-amine |
| SMILES | C=CCC(CC=C)(C(=C)/C=C/c1ccccc1)c1c(NC)ccc2ccccc12 |
| InChI | InChI=1S/C28H29N/c1-5-20-28(21-6-2,22(3)16-17-23-12-8-7-9-13-23)27-25-15-11-10-14-24(25)18-19-26(27)29-4/h5-19,29H,1-3,20-21H2,4H3/b17-16+ |
| InChIKey | GCLJIXSPXMEGSH-WUKNDPDISA-N |
| XLogP | 7.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|