C25H32FN3S — CID 143795129
5-(2-fluoro-5-methylphenyl)-3-methylspiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene];N-methylpent-4-en-1-amine (PubChem CID 143795129) has the molecular formula C25H32FN3S and a molecular weight of 425.62 g/mol. Its IUPAC name is 5-(2-fluoro-5-methylphenyl)-3-methylspiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene];N-methylpent-4-en-1-amine.
| Compound Name | 5-(2-fluoro-5-methylphenyl)-3-methylspiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene];N-methylpent-4-en-1-amine |
|---|---|
| PubChem CID | 143795129 |
| Molecular Formula | C25H32FN3S |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 5-(2-fluoro-5-methylphenyl)-3-methylspiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene];N-methylpent-4-en-1-amine |
| SMILES | C=CCCCNC.Cc1ccc(F)c(C2=NN(C)C3(CCCc4ccccc43)S2)c1 |
| InChI | InChI=1S/C19H19FN2S.C6H13N/c1-13-9-10-17(20)15(12-13)18-21-22(2)19(23-18)11-5-7-14-6-3-4-8-16(14)19;1-3-4-5-6-7-2/h3-4,6,8-10,12H,5,7,11H2,1-2H3;3,7H,1,4-6H2,2H3 |
| InChIKey | IIGWZNWUZZWWIS-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|