C21H24O4 — CID 143796681
3-[4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-2-methylphenyl]benzaldehyde (PubChem CID 143796681) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is 3-[4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-2-methylphenyl]benzaldehyde.
| Compound Name | 3-[4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-2-methylphenyl]benzaldehyde |
|---|---|
| PubChem CID | 143796681 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 3-[4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-2-methylphenyl]benzaldehyde |
| SMILES | Cc1cc(OCC2COC(C)(C)OC2)ccc1-c1cccc(C=O)c1 |
| InChI | InChI=1S/C21H24O4/c1-15-9-19(23-12-17-13-24-21(2,3)25-14-17)7-8-20(15)18-6-4-5-16(10-18)11-22/h4-11,17H,12-14H2,1-3H3 |
| InChIKey | XQPIZRRAUOHJPY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|