C9H9NOS — CID 143798287
3-methyl-6H-cyclohepta[d][1,3]thiazol-2-one (PubChem CID 143798287) has the molecular formula C9H9NOS and a molecular weight of 179.24 g/mol. Its IUPAC name is 3-methyl-6H-cyclohepta[d][1,3]thiazol-2-one.
| Compound Name | 3-methyl-6H-cyclohepta[d][1,3]thiazol-2-one |
|---|---|
| PubChem CID | 143798287 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 3-methyl-6H-cyclohepta[d][1,3]thiazol-2-one |
| SMILES | Cn1c2c(sc1=O)C=CCC=C2 |
| InChI | InChI=1S/C9H9NOS/c1-10-7-5-3-2-4-6-8(7)12-9(10)11/h3-6H,2H2,1H3 |
| InChIKey | AAULCZQFGXEQLR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |