C18H32O2 — CID 143806776
ethane;1-[(E)-7-ethoxyhept-2-enoxy]-4-methylcyclohexa-1,3-diene (PubChem CID 143806776) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is ethane;1-[(E)-7-ethoxyhept-2-enoxy]-4-methylcyclohexa-1,3-diene.
| Compound Name | ethane;1-[(E)-7-ethoxyhept-2-enoxy]-4-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143806776 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | ethane;1-[(E)-7-ethoxyhept-2-enoxy]-4-methylcyclohexa-1,3-diene |
| SMILES | CC.CCOCCCC/C=C/COC1=CC=C(C)CC1 |
| InChI | InChI=1S/C16H26O2.C2H6/c1-3-17-13-7-5-4-6-8-14-18-16-11-9-15(2)10-12-16;1-2/h6,8-9,11H,3-5,7,10,12-14H2,1-2H3;1-2H3/b8-6+; |
| InChIKey | YBOFINVPVLRJEX-WVLIHFOGSA-N |
| XLogP | 5.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|