C22H23F5O3 — CID 89145197
1-[(3Z,7E)-1,1-difluoro-7,9-dimethoxy-2,5,6-trimethylidenedeca-3,7,9-trienoxy]-4-(trifluoromethyl)cyclohexa-1,3-diene (PubChem CID 89145197) has the molecular formula C22H23F5O3 and a molecular weight of 430.41 g/mol. Its IUPAC name is 1-[(3Z,7E)-1,1-difluoro-7,9-dimethoxy-2,5,6-trimethylidenedeca-3,7,9-trienoxy]-4-(trifluoromethyl)cyclohexa-1,3-diene.
| Compound Name | 1-[(3Z,7E)-1,1-difluoro-7,9-dimethoxy-2,5,6-trimethylidenedeca-3,7,9-trienoxy]-4-(trifluoromethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 89145197 |
| Molecular Formula | C22H23F5O3 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 1-[(3Z,7E)-1,1-difluoro-7,9-dimethoxy-2,5,6-trimethylidenedeca-3,7,9-trienoxy]-4-(trifluoromethyl)cyclohexa-1,3-diene |
| SMILES | C=C(/C=C(\OC)C(=C)C(=C)/C=C\C(=C)C(F)(F)OC1=CC=C(C(F)(F)F)CC1)OC |
| InChI | InChI=1S/C22H23F5O3/c1-14(17(4)20(29-6)13-16(3)28-5)7-8-15(2)22(26,27)30-19-11-9-18(10-12-19)21(23,24)25/h7-9,11,13H,1-4,10,12H2,5-6H3/b8-7-,20-13+ |
| InChIKey | GLAQCWUOHGMMNH-LNKDYXAPSA-N |
| XLogP | 6.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|