C9H11NO — CID 143806885
(3E)-4-methylidene-3-(2-methylprop-2-enylidene)pyrrolidin-2-one (PubChem CID 143806885) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is (3E)-4-methylidene-3-(2-methylprop-2-enylidene)pyrrolidin-2-one.
| Compound Name | (3E)-4-methylidene-3-(2-methylprop-2-enylidene)pyrrolidin-2-one |
|---|---|
| PubChem CID | 143806885 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | (3E)-4-methylidene-3-(2-methylprop-2-enylidene)pyrrolidin-2-one |
| SMILES | C=C(C)/C=C1\C(=C)CNC1=O |
| InChI | InChI=1S/C9H11NO/c1-6(2)4-8-7(3)5-10-9(8)11/h4H,1,3,5H2,2H3,(H,10,11)/b8-4+ |
| InChIKey | MMDIXKWMNZTORI-XBXARRHUSA-N |
| XLogP | 1.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|