C16H32S — CID 143808707
1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene;ethane (PubChem CID 143808707) has the molecular formula C16H32S and a molecular weight of 256.50 g/mol. Its IUPAC name is 1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene;ethane.
| Compound Name | 1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene;ethane |
|---|---|
| PubChem CID | 143808707 |
| Molecular Formula | C16H32S |
| Molecular Weight | 256.50 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene;ethane |
| SMILES | C1CCC2C(C1)SC1CCCCC12.CC.CC |
| InChI | InChI=1S/C12H20S.2C2H6/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;2*1-2/h9-12H,1-8H2;2*1-2H3 |
| InChIKey | ILJGJPATWWIFES-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.50 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |