C13H21N3O2 — CID 143810488
2-amino-3-[4-[(E)-(propan-2-ylhydrazinylidene)methyl]cyclohexa-2,4-dien-1-yl]propanoic acid (PubChem CID 143810488) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-amino-3-[4-[(E)-(propan-2-ylhydrazinylidene)methyl]cyclohexa-2,4-dien-1-yl]propanoic acid.
| Compound Name | 2-amino-3-[4-[(E)-(propan-2-ylhydrazinylidene)methyl]cyclohexa-2,4-dien-1-yl]propanoic acid |
|---|---|
| PubChem CID | 143810488 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 2-amino-3-[4-[(E)-(propan-2-ylhydrazinylidene)methyl]cyclohexa-2,4-dien-1-yl]propanoic acid |
| SMILES | CC(C)N/N=C/C1=CCC(CC(N)C(=O)O)C=C1 |
| InChI | InChI=1S/C13H21N3O2/c1-9(2)16-15-8-11-5-3-10(4-6-11)7-12(14)13(17)18/h3,5-6,8-10,12,16H,4,7,14H2,1-2H3,(H,17,18)/b15-8+ |
| InChIKey | XOAMMEXKQTWJNO-OVCLIPMQSA-N |
| XLogP | 1.27 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|