C10H14O — CID 143818485
4,5-bis(prop-1-en-2-yl)-2,3-dihydrofuran (PubChem CID 143818485) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 4,5-bis(prop-1-en-2-yl)-2,3-dihydrofuran.
| Compound Name | 4,5-bis(prop-1-en-2-yl)-2,3-dihydrofuran |
|---|---|
| PubChem CID | 143818485 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 4,5-bis(prop-1-en-2-yl)-2,3-dihydrofuran |
| SMILES | C=C(C)C1=C(C(=C)C)OCC1 |
| InChI | InChI=1S/C10H14O/c1-7(2)9-5-6-11-10(9)8(3)4/h1,3,5-6H2,2,4H3 |
| InChIKey | XUVMZOCCFSJNLS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |